Structure of PDB 3cwe Chain A Binding Site BS01 |
|
|
Ligand ID | 825 |
InChI | InChI=1S/C22H18BrF2O4P/c23-20-14-15(11-12-19(20)22(24,25)30(27,28)29)13-18(16-7-3-1-4-8-16)21(26)17-9-5-2-6-10-17/h1-12,14,18H,13H2,(H2,27,28,29)/t18-/m1/s1 |
InChIKey | WDTMVBQZDFMOIK-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | Brc1cc(ccc1C(F)(F)P(=O)(O)O)CC(c2ccccc2)C(=O)c3ccccc3 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)C(Cc2ccc(c(c2)Br)C(F)(F)P(=O)(O)O)C(=O)c3ccccc3 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)[C@@H](Cc2ccc(c(c2)Br)C(F)(F)P(=O)(O)O)C(=O)c3ccccc3 | CACTVS 3.341 | O[P](O)(=O)C(F)(F)c1ccc(C[CH](C(=O)c2ccccc2)c3ccccc3)cc1Br | CACTVS 3.341 | O[P](O)(=O)C(F)(F)c1ccc(C[C@@H](C(=O)c2ccccc2)c3ccccc3)cc1Br |
|
Formula | C22 H18 Br F2 O4 P |
Name | [{2-bromo-4-[(2R)-3-oxo-2,3-diphenylpropyl]phenyl}(difluoro)methyl]phosphonic acid |
ChEMBL | |
DrugBank | DB07263 |
ZINC | ZINC000024980465
|
PDB chain | 3cwe Chain A Residue 784
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|