Structure of PDB 3cqe Chain A Binding Site BS01 |
|
|
Ligand ID | P91 |
InChI | InChI=1S/C20H15BrClN3O4/c1-25-12-8-10(9-4-2-3-5-11(9)22)13-15(19(28)24-18(13)27)14(12)16(21)17(25)20(29)23-6-7-26/h2-5,8,26H,6-7H2,1H3,(H,23,29)(H,24,27,28) |
InChIKey | XUAHLMVOYLUYSB-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | Clc4ccccc4c2c1C(=O)NC(=O)c1c3c(c2)n(c(c3Br)C(=O)NCCO)C | OpenEye OEToolkits 1.5.0 | Cn1c2cc(c3c(c2c(c1C(=O)NCCO)Br)C(=O)NC3=O)c4ccccc4Cl | CACTVS 3.341 | Cn1c2cc(c3ccccc3Cl)c4C(=O)NC(=O)c4c2c(Br)c1C(=O)NCCO |
|
Formula | C20 H15 Br Cl N3 O4 |
Name | 8-bromo-4-(2-chlorophenyl)-N-(2-hydroxyethyl)-6-methyl-1,3-dioxo-1,2,3,6-tetrahydropyrrolo[3,4-e]indole-7-carboxamide |
ChEMBL | |
DrugBank | DB08365 |
ZINC | ZINC000038256084
|
PDB chain | 3cqe Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D426 K428 |
Catalytic site (residue number reindexed from 1) |
D134 K136 |
Enzyme Commision number |
2.7.10.2: non-specific protein-tyrosine kinase. |
|
|
|