Structure of PDB 3cgo Chain A Binding Site BS01 |
|
|
Ligand ID | JNO |
InChI | InChI=1S/C19H23N7O/c1-20-18(27)13-25-10-6-14(7-11-25)23-19-21-8-5-15(24-19)16-12-22-17-4-2-3-9-26(16)17/h2-5,8-9,12,14H,6-7,10-11,13H2,1H3,(H,20,27)(H,21,23,24) |
InChIKey | AJLILYAPRHIFAS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CNC(=O)CN1CCC(CC1)Nc2nccc(n2)c3cnc4ccccn34 | ACDLabs 10.04 | O=C(NC)CN4CCC(Nc3nc(c2cnc1ccccn12)ccn3)CC4 | OpenEye OEToolkits 1.5.0 | CNC(=O)CN1CCC(CC1)Nc2nccc(n2)c3cnc4n3cccc4 |
|
Formula | C19 H23 N7 O |
Name | 2-{4-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]piperidin-1-yl}-N-methylacetamide |
ChEMBL | CHEMBL485323 |
DrugBank | DB08026 |
ZINC | ZINC000016052751
|
PDB chain | 3cgo Chain A Residue 510
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|