Structure of PDB 3c49 Chain A Binding Site BS01 |
|
|
Ligand ID | KU8 |
InChI | InChI=1S/C21H21FN4O2/c22-18-7-6-14(12-17(18)21(28)26-10-3-8-23-9-11-26)13-19-15-4-1-2-5-16(15)20(27)25-24-19/h1-2,4-7,12,23H,3,8-11,13H2,(H,25,27) |
InChIKey | HGEPGGJUGUMFHT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Fc1ccc(CC2=NNC(=O)c3ccccc23)cc1C(=O)N4CCCNCC4 | ACDLabs 10.04 | O=C(N1CCNCCC1)c2cc(ccc2F)CC4=NNC(=O)c3ccccc34 | OpenEye OEToolkits 1.5.0 | c1ccc2c(c1)C(=NNC2=O)Cc3ccc(c(c3)C(=O)N4CCCNCC4)F |
|
Formula | C21 H21 F N4 O2 |
Name | 4-[3-(1,4-diazepan-1-ylcarbonyl)-4-fluorobenzyl]phthalazin-1(2H)-one |
ChEMBL | CHEMBL380648 |
DrugBank | DB08058 |
ZINC | ZINC000003821234
|
PDB chain | 3c49 Chain A Residue 601
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|