Structure of PDB 3byo Chain A Binding Site BS01 |
|
|
Ligand ID | AM9 |
InChI | InChI=1S/C31H30N8O/c1-20-7-6-8-21(2)27(20)39-29(40)24-19-32-30(35-28(24)38-26-10-5-4-9-25(26)34-31(38)39)33-22-11-13-23(14-12-22)37-17-15-36(3)16-18-37/h4-14,19H,15-18H2,1-3H3,(H,32,33,35) |
InChIKey | BHJJWVDKNXABFS-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CN1CCN(CC1)c2ccc(Nc3ncc4C(=O)N(c5nc6ccccc6n5c4n3)c7c(C)cccc7C)cc2 | OpenEye OEToolkits 1.5.0 | Cc1cccc(c1N2c3nc4ccccc4n3-c5c(cnc(n5)Nc6ccc(cc6)N7CCN(CC7)C)C2=O)C | ACDLabs 10.04 | O=C3N(c1c(cccc1C)C)c6nc7ccccc7n6c2nc(ncc23)Nc4ccc(cc4)N5CCN(C)CC5 |
|
Formula | C31 H30 N8 O |
Name | 6-(2,6-dimethylphenyl)-2-{[4-(4-methylpiperazin-1-yl)phenyl]amino}pyrimido[5',4':5,6]pyrimido[1,2-a]benzimidazol-5(6H)-one |
ChEMBL | CHEMBL410295 |
DrugBank | |
ZINC | ZINC000053214756
|
PDB chain | 3byo Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|