Structure of PDB 3bqr Chain A Binding Site BS01 |
|
|
Ligand ID | 4RB |
InChI | InChI=1S/C17H18N4O3/c1-2-13(10-22)19-15-7-8-16-18-9-14(21(16)20-15)11-3-5-12(6-4-11)17(23)24/h3-9,13,22H,2,10H2,1H3,(H,19,20)(H,23,24)/t13-/m1/s1 |
InChIKey | KKZYGUVAFJCULH-CYBMUJFWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC[C@H](CO)Nc1ccc2ncc(n2n1)c3ccc(cc3)C(O)=O | OpenEye OEToolkits 1.5.0 | CCC(CO)Nc1ccc2ncc(n2n1)c3ccc(cc3)C(=O)O | CACTVS 3.341 | CC[CH](CO)Nc1ccc2ncc(n2n1)c3ccc(cc3)C(O)=O | ACDLabs 10.04 | O=C(O)c3ccc(c1cnc2ccc(nn12)NC(CC)CO)cc3 | OpenEye OEToolkits 1.5.0 | CC[C@H](CO)Nc1ccc2ncc(n2n1)c3ccc(cc3)C(=O)O |
|
Formula | C17 H18 N4 O3 |
Name | 4-(6-{[(1R)-1-(hydroxymethyl)propyl]amino}imidazo[1,2-b]pyridazin-3-yl)benzoic acid |
ChEMBL | |
DrugBank | DB07125 |
ZINC | ZINC000033943568
|
PDB chain | 3bqr Chain A Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|