Structure of PDB 3bi6 Chain A Binding Site BS01 |
|
|
Ligand ID | 396 |
InChI | InChI=1S/C28H25ClN4O4/c1-32-20-13-18(26(35)30-8-11-33-9-4-5-10-33)22(34)14-17(20)23-21(32)12-16(15-6-2-3-7-19(15)29)24-25(23)28(37)31-27(24)36/h2-3,6-7,12-14,34H,4-5,8-11H2,1H3,(H,30,35)(H,31,36,37) |
InChIKey | LFRLUVCEFWYSFT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Cn1c2cc(c(O)cc2c3c1cc(c4ccccc4Cl)c5C(=O)NC(=O)c35)C(=O)NCCN6CCCC6 | ACDLabs 10.04 | Clc1ccccc1c2cc6c(c3c2C(=O)NC3=O)c5c(cc(C(=O)NCCN4CCCC4)c(O)c5)n6C | OpenEye OEToolkits 1.5.0 | Cn1c2cc(c3c(c2c4c1cc(c(c4)O)C(=O)NCCN5CCCC5)C(=O)NC3=O)c6ccccc6Cl |
|
Formula | C28 H25 Cl N4 O4 |
Name | 4-(2-chlorophenyl)-9-hydroxy-6-methyl-1,3-dioxo-N-(2-pyrrolidin-1-ylethyl)pyrrolo[3,4-g]carbazole-8-carboxamide |
ChEMBL | CHEMBL272267 |
DrugBank | |
ZINC | ZINC000016052880
|
PDB chain | 3bi6 Chain A Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
D426 K428 |
Catalytic site (residue number reindexed from 1) |
D134 K136 |
Enzyme Commision number |
2.7.10.2: non-specific protein-tyrosine kinase. |
|
|
|