Structure of PDB 3b68 Chain A Binding Site BS01 |
|
|
Ligand ID | B68 |
InChI | InChI=1S/C19H18F3N3O6/c1-11(26)23-12-3-6-14(7-4-12)31-10-18(2,28)17(27)24-13-5-8-16(25(29)30)15(9-13)19(20,21)22/h3-9,28H,10H2,1-2H3,(H,23,26)(H,24,27)/t18-/m0/s1 |
InChIKey | YVXVTLGIDOACBJ-SFHVURJKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(=O)Nc1ccc(cc1)OC[C@@](C)(C(=O)Nc2ccc(c(c2)C(F)(F)F)[N+](=O)[O-])O | OpenEye OEToolkits 1.5.0 | CC(=O)Nc1ccc(cc1)OCC(C)(C(=O)Nc2ccc(c(c2)C(F)(F)F)[N+](=O)[O-])O | CACTVS 3.341 | CC(=O)Nc1ccc(OC[C@](C)(O)C(=O)Nc2ccc(c(c2)C(F)(F)F)[N+]([O-])=O)cc1 | ACDLabs 10.04 | FC(F)(F)c1cc(ccc1[N+]([O-])=O)NC(=O)C(O)(COc2ccc(cc2)NC(=O)C)C | CACTVS 3.341 | CC(=O)Nc1ccc(OC[C](C)(O)C(=O)Nc2ccc(c(c2)C(F)(F)F)[N+]([O-])=O)cc1 |
|
Formula | C19 H18 F3 N3 O6 |
Name | (2S)-3-[4-(acetylamino)phenoxy]-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide |
ChEMBL | CHEMBL125236 |
DrugBank | DB07423 |
ZINC | ZINC000003991693
|
PDB chain | 3b68 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|