Structure of PDB 3b67 Chain A Binding Site BS01 |
|
|
Ligand ID | B67 |
InChI | InChI=1S/C17H10F8N2O5/c1-16(29,5-32-14-12(21)10(19)9(18)11(20)13(14)22)15(28)26-6-2-3-8(27(30)31)7(4-6)17(23,24)25/h2-4,29H,5H2,1H3,(H,26,28)/t16-/m0/s1 |
InChIKey | MMNRWNREMUMYQG-INIZCTEOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | C[C@](O)(COc1c(F)c(F)c(F)c(F)c1F)C(=O)Nc2ccc(c(c2)C(F)(F)F)[N+]([O-])=O | ACDLabs 10.04 | [O-][N+](=O)c1ccc(cc1C(F)(F)F)NC(=O)C(O)(COc2c(F)c(F)c(F)c(F)c2F)C | OpenEye OEToolkits 1.5.0 | C[C@](COc1c(c(c(c(c1F)F)F)F)F)(C(=O)Nc2ccc(c(c2)C(F)(F)F)[N+](=O)[O-])O | CACTVS 3.341 | C[C](O)(COc1c(F)c(F)c(F)c(F)c1F)C(=O)Nc2ccc(c(c2)C(F)(F)F)[N+]([O-])=O | OpenEye OEToolkits 1.5.0 | CC(COc1c(c(c(c(c1F)F)F)F)F)(C(=O)Nc2ccc(c(c2)C(F)(F)F)[N+](=O)[O-])O |
|
Formula | C17 H10 F8 N2 O5 |
Name | (2S)-2-hydroxy-2-methyl-N-[4-nitro-3-(trifluoromethyl)phenyl]-3-(pentafluorophenoxy)propanamide |
ChEMBL | CHEMBL124493 |
DrugBank | DB07422 |
ZINC | ZINC000039037704
|
PDB chain | 3b67 Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|