Structure of PDB 3b28 Chain A Binding Site BS01 |
|
|
Ligand ID | B2X |
InChI | InChI=1S/C16H13ClN4OS/c1-23-16-20-14(19-15(18)21-16)13-10-4-2-3-8-6-22-7-9(12(8)10)5-11(13)17/h2-5H,6-7H2,1H3,(H2,18,19,20,21) |
InChIKey | FPTCGMGLTQPTGE-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc2c(c1cccc3c1c(c2)COC3)c4nc(nc(SC)n4)N | OpenEye OEToolkits 1.7.2 | CSc1nc(nc(n1)N)c2c3cccc4c3c(cc2Cl)COC4 | CACTVS 3.370 | CSc1nc(N)nc(n1)c2c(Cl)cc3COCc4cccc2c34 |
|
Formula | C16 H13 Cl N4 O S |
Name | 4-(5-chloro-1H,3H-benzo[de]isochromen-6-yl)-6-(methylsulfanyl)-1,3,5-triazin-2-amine |
ChEMBL | CHEMBL1834096 |
DrugBank | |
ZINC | ZINC000072126864
|
PDB chain | 3b28 Chain A Residue 237
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|