Structure of PDB 3b0q Chain A Binding Site BS01 |
|
|
Ligand ID | MC5 |
InChI | InChI=1S/C21H16FNO3S/c22-18-4-2-1-3-16(18)12-26-17-8-7-14-9-13(5-6-15(14)11-17)10-19-20(24)23-21(25)27-19/h1-9,11,19H,10,12H2,(H,23,24,25)/t19-/m0/s1 |
InChIKey | PKWDZWYVIHVNKS-IBGZPJMESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Fc1ccccc1COc2ccc3cc(C[CH]4SC(=O)NC4=O)ccc3c2 | OpenEye OEToolkits 1.7.2 | c1ccc(c(c1)COc2ccc3cc(ccc3c2)CC4C(=O)NC(=O)S4)F | CACTVS 3.370 | Fc1ccccc1COc2ccc3cc(C[C@@H]4SC(=O)NC4=O)ccc3c2 | ACDLabs 12.01 | Fc1ccccc1COc3ccc2cc(ccc2c3)CC4SC(=O)NC4=O | OpenEye OEToolkits 1.7.2 | c1ccc(c(c1)COc2ccc3cc(ccc3c2)C[C@H]4C(=O)NC(=O)S4)F |
|
Formula | C21 H16 F N O3 S |
Name | (5S)-5-({6-[(2-fluorobenzyl)oxy]naphthalen-2-yl}methyl)-1,3-thiazolidine-2,4-dione; Netoglitazone |
ChEMBL | |
DrugBank | |
ZINC | ZINC000003633833
|
PDB chain | 3b0q Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|