Structure of PDB 3ara Chain A Binding Site BS01 |
|
|
Ligand ID | MKH |
InChI | InChI=1S/C24H27N3O5S/c28-22-14-17-26(23(29)25-22)15-8-18-33(31,32)27-16-7-13-21(27)24(30,19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-6,9-12,14,17,21,30H,7-8,13,15-16,18H2,(H,25,28,29)/t21-/m1/s1 |
InChIKey | NBGXNYZRJDHHHU-OAQYLSRUSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=S(=O)(N3C(C(O)(c1ccccc1)c2ccccc2)CCC3)CCCN4C=CC(=O)NC4=O | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)C(c2ccccc2)([C@H]3CCCN3S(=O)(=O)CCCN4C=CC(=O)NC4=O)O | CACTVS 3.370 | OC([CH]1CCCN1[S](=O)(=O)CCCN2C=CC(=O)NC2=O)(c3ccccc3)c4ccccc4 | OpenEye OEToolkits 1.7.0 | c1ccc(cc1)C(c2ccccc2)(C3CCCN3S(=O)(=O)CCCN4C=CC(=O)NC4=O)O | CACTVS 3.370 | OC([C@H]1CCCN1[S](=O)(=O)CCCN2C=CC(=O)NC2=O)(c3ccccc3)c4ccccc4 |
|
Formula | C24 H27 N3 O5 S |
Name | 1-[3-({(2R)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl}sulfonyl)propyl]pyrimidine-2,4(1H,3H)-dione |
ChEMBL | CHEMBL1234349 |
DrugBank | |
ZINC | ZINC000058651014
|
PDB chain | 3ara Chain A Residue 165
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|