Structure of PDB 3aos Chain A Binding Site BS01 |
|
|
Ligand ID | JH2 |
InChI | InChI=1S/C17H28O3/c1-6-17(4)15(20-17)11-10-13(2)8-7-9-14(3)12-16(18)19-5/h8,12,15H,6-7,9-11H2,1-5H3/b13-8+,14-12+/t15-,17+/m1/s1 |
InChIKey | CPVQJXZBSGXTGJ-TZDLBHCHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC[C]1(C)O[CH]1CCC(C)=CCCC(C)=CC(=O)OC | OpenEye OEToolkits 1.7.0 | CC[C@]1([C@H](O1)CC/C(=C/CC/C(=C/C(=O)OC)/C)/C)C | ACDLabs 12.01 | O=C(OC)\C=C(/C)CC\C=C(/C)CCC1OC1(CC)C | CACTVS 3.370 | CC[C@]1(C)O[C@@H]1CC/C(C)=C/CC/C(C)=C/C(=O)OC | OpenEye OEToolkits 1.7.0 | CCC1(C(O1)CCC(=CCCC(=CC(=O)OC)C)C)C |
|
Formula | C17 H28 O3 |
Name | methyl (2E,6E)-9-[(2R,3S)-3-ethyl-3-methyloxiran-2-yl]-3,7-dimethylnona-2,6-dienoate; JH II, Juvenile hormone II |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3aos Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|