Structure of PDB 3aau Chain A Binding Site BS01 |
|
|
Ligand ID | GZC |
InChI | InChI=1S/C18H22N8O2/c19-17(20)25-13-1-3-15(27)11(7-13)9-23-5-6-24-10-12-8-14(26-18(21)22)2-4-16(12)28/h1-4,7-10,27-28H,5-6H2,(H4,19,20,25)(H4,21,22,26)/b23-9+,24-10+ |
InChIKey | VDYARAMMHWMLLR-WDBPGAOMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | [H]/N=C(\Nc1cc(c(cc1)O)/C=N/CC/N=C/c2c(ccc(c2)N/C(=N/[H])/N)O)/N | OpenEye OEToolkits 1.7.0 | c1cc(c(cc1NC(=N)N)C=NCCN=Cc2cc(ccc2O)NC(=N)N)O | CACTVS 3.352 | NC(=N)Nc1ccc(O)c(C=NCCN=Cc2cc(NC(N)=N)ccc2O)c1 |
|
Formula | C18 H22 N8 O2 |
Name | N,N'''-{ethane-1,2-diylbis[nitrilo(E)methylylidene(4-hydroxybenzene-3,1-diyl)]}diguanidine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058650039
|
PDB chain | 3aau Chain A Residue 3001
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|