Structure of PDB 2zjl Chain A Binding Site BS01 |
|
|
Ligand ID | F1L |
InChI | InChI=1S/C18H27BrN2O3S/c1-23-16-11-14(19)10-13(18(16)24-2)12-21-7-5-15(6-8-21)20-17(22)4-3-9-25/h10-11,15,25H,3-9,12H2,1-2H3,(H,20,22) |
InChIKey | HESMISSJMKCCAV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | COc1cc(cc(c1OC)CN2CCC(CC2)NC(=O)CCCS)Br | CACTVS 3.341 | COc1cc(Br)cc(CN2CCC(CC2)NC(=O)CCCS)c1OC | ACDLabs 10.04 | Brc1cc(c(OC)c(OC)c1)CN2CCC(NC(=O)CCCS)CC2 |
|
Formula | C18 H27 Br N2 O3 S |
Name | N-[1-(5-bromo-2,3-dimethoxybenzyl)piperidin-4-yl]-4-sulfanylbutanamide; N-[1-(5-bromo-2,3-dimethoxy-benzyl)-piperidin-4-yl]-4-mercapto-butyramide |
ChEMBL | |
DrugBank | DB07738 |
ZINC | ZINC000039029989
|
PDB chain | 2zjl Chain A Residue 449
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|