Structure of PDB 2zbh Chain A Binding Site BS01 |
|
|
Ligand ID | BVL |
InChI | InChI=1S/C21H22O4/c1-14(2)4-8-16-12-18(20(24)13-21(16)25-3)19(23)11-7-15-5-9-17(22)10-6-15/h4-7,9-13,22,24H,8H2,1-3H3/b11-7+ |
InChIKey | ZUGCRBMNFSAUOC-YRNVUSSQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | COc1cc(O)c(cc1CC=C(C)C)C(=O)C=Cc2ccc(O)cc2 | CACTVS 3.341 | COc1cc(O)c(cc1CC=C(C)C)C(=O)/C=C/c2ccc(O)cc2 | OpenEye OEToolkits 1.5.0 | CC(=CCc1cc(c(cc1OC)O)C(=O)C=Cc2ccc(cc2)O)C | ACDLabs 10.04 | O=C(c1c(O)cc(OC)c(c1)C\C=C(/C)C)\C=C\c2ccc(O)cc2 | OpenEye OEToolkits 1.5.0 | CC(=CCc1cc(c(cc1OC)O)C(=O)\C=C\c2ccc(cc2)O)C |
|
Formula | C21 H22 O4 |
Name | (2E)-1-[2-hydroxy-4-methoxy-5-(3-methylbut-2-en-1-yl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one; (E)-1-[2-hydroxy-4-methoxy-5-(3-methylbut-2-enyl)phenyl]-3-(4-hydroxyphenyl)prop-2-en-1-one |
ChEMBL | CHEMBL1231518 |
DrugBank | DB07500 |
ZINC | ZINC000019816069
|
PDB chain | 2zbh Chain A Residue 134
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|