Structure of PDB 2ym8 Chain A Binding Site BS01 |
|
|
Ligand ID | YM8 |
InChI | InChI=1S/C19H19ClN6O/c1-12(11-26(2)3)27-19-16(8-21)22-10-18(25-19)24-17-7-13-5-4-6-15(20)14(13)9-23-17/h4-7,9-10,12H,11H2,1-3H3,(H,23,24,25)/t12-/m1/s1 |
InChIKey | SRBJWIBAMIKCMV-GFCCVEGCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | C[CH](CN(C)C)Oc1nc(Nc2cc3cccc(Cl)c3cn2)cnc1C#N | OpenEye OEToolkits 1.9.2 | C[C@H](CN(C)C)Oc1c(ncc(n1)Nc2cc3cccc(c3cn2)Cl)C#N | ACDLabs 12.01 | Clc2cccc1cc(ncc12)Nc3nc(OC(CN(C)C)C)c(nc3)C#N | OpenEye OEToolkits 1.9.2 | CC(CN(C)C)Oc1c(ncc(n1)Nc2cc3cccc(c3cn2)Cl)C#N | CACTVS 3.385 | C[C@H](CN(C)C)Oc1nc(Nc2cc3cccc(Cl)c3cn2)cnc1C#N |
|
Formula | C19 H19 Cl N6 O |
Name | (R)-5-(8-CHLOROISOQUINOLIN-3-YLAMINO)-3-(1-(DIMETHYLAMINO)PROPAN-2-YLOXY)PYRAZINE-2-CARBONITRILE |
ChEMBL | CHEMBL1928705 |
DrugBank | |
ZINC | ZINC000068207132
|
PDB chain | 2ym8 Chain A Residue 1271
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|