Structure of PDB 2ym7 Chain A Binding Site BS01 |
|
|
Ligand ID | YM7 |
InChI | InChI=1S/C15H18N8/c16-6-12-8-20-15(9-18-12)23-14-5-13(21-10-22-14)19-7-11-1-3-17-4-2-11/h5,8-11,17H,1-4,7H2,(H2,19,20,21,22,23) |
InChIKey | LNWARQATROLGJR-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | N#Cc1ncc(nc1)Nc3ncnc(NCC2CCNCC2)c3 | OpenEye OEToolkits 1.9.2 | c1c(ncnc1Nc2cnc(cn2)C#N)NCC3CCNCC3 | CACTVS 3.385 | N#Cc1cnc(Nc2cc(NCC3CCNCC3)ncn2)cn1 |
|
Formula | C15 H18 N8 |
Name | 5-({6-[(piperidin-4-ylmethyl)amino]pyrimidin-4-yl}amino)pyrazine-2-carbonitrile |
ChEMBL | CHEMBL1928689 |
DrugBank | |
ZINC | ZINC000082153556
|
PDB chain | 2ym7 Chain A Residue 1272
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|