Structure of PDB 2ym6 Chain A Binding Site BS01 |
|
|
Ligand ID | YM6 |
InChI | InChI=1S/C14H16N6O/c15-5-9-7-20(3-4-21-9)14-12-10-1-2-16-6-11(10)19-13(12)17-8-18-14/h1-2,6,8-9H,3-5,7,15H2,(H,17,18,19)/t9-/m1/s1 |
InChIKey | ZOMFTMSIQWYIQV-SECBINFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | NC[C@@H]1CN(CCO1)c2ncnc3[nH]c4cnccc4c23 | OpenEye OEToolkits 2.0.7 | c1cncc2c1c3c([nH]2)ncnc3N4CCO[C@@H](C4)CN | CACTVS 3.385 | NC[CH]1CN(CCO1)c2ncnc3[nH]c4cnccc4c23 | OpenEye OEToolkits 2.0.7 | c1cncc2c1c3c([nH]2)ncnc3N4CCOC(C4)CN |
|
Formula | C14 H16 N6 O |
Name | 1-[(2R)-4-(9H-pyrido[4',3':4,5]pyrrolo[2,3-d]pyrimidin-4-yl)morpholin-2-yl]methanamine |
ChEMBL | |
DrugBank | |
ZINC | ZINC000059127606
|
PDB chain | 2ym6 Chain A Residue 1271
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|