Structure of PDB 2ym4 Chain A Binding Site BS01 |
|
|
Ligand ID | 4YM |
InChI | InChI=1S/C21H22N6O3/c1-2-29-21(28)16-11-24-20-17(19(16)27-6-7-30-15(10-23)12-27)18(25-26-20)14-5-3-4-13(8-14)9-22/h3-5,8,11,15H,2,6-7,10,12,23H2,1H3,(H,24,25,26)/t15-/m1/s1 |
InChIKey | XEAFNJRJCDEJPR-OAHLLOKOSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CCOC(=O)c1cnc2[nH]nc(c3cccc(c3)C#N)c2c1N4CCO[CH](CN)C4 | OpenEye OEToolkits 2.0.7 | CCOC(=O)c1cnc2c(c1N3CCOC(C3)CN)c(n[nH]2)c4cccc(c4)C#N | CACTVS 3.385 | CCOC(=O)c1cnc2[nH]nc(c3cccc(c3)C#N)c2c1N4CCO[C@H](CN)C4 | OpenEye OEToolkits 2.0.7 | CCOC(=O)c1cnc2c(c1N3CCO[C@@H](C3)CN)c(n[nH]2)c4cccc(c4)C#N |
|
Formula | C21 H22 N6 O3 |
Name | ethyl 4-[(2R)-2-(aminomethyl)morpholin-4-yl]-3-(3-cyanophenyl)-1H-pyrazolo[3,4-b]pyridine-5-carboxylate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000082155048
|
PDB chain | 2ym4 Chain A Residue 1271
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|