Structure of PDB 2yke Chain A Binding Site BS01 |
|
|
Ligand ID | YKE |
InChI | InChI=1S/C29H19N5O/c35-29(20-8-4-12-23-17(20)11-5-14-31-23)34-27-19-7-2-1-6-18(19)26-21(27)9-3-10-22(26)28-32-24-13-15-30-16-25(24)33-28/h1-16,22H,(H,32,33)(H,34,35)/t22-/m1/s1 |
InChIKey | YDMHGGAKCRWQBD-JOCHJYFZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O=C(NC1=C2C=CC=CC2=C3[CH](C=CC=C13)c4[nH]c5cnccc5n4)c6cccc7ncccc67 | ACDLabs 12.01 | O=C(c2c1cccnc1ccc2)NC=6C5=CC=CC(c4nc3ccncc3n4)C5=C7C=CC=CC=67 | OpenEye OEToolkits 1.7.2 | c1cc(c2cccnc2c1)C(=O)NC3=C4C=CC=CC4=C5C3=CC=CC5c6[nH]c7cnccc7n6 | CACTVS 3.370 | O=C(NC1=C2C=CC=CC2=C3[C@@H](C=CC=C13)c4[nH]c5cnccc5n4)c6cccc7ncccc67 |
|
Formula | C29 H19 N5 O |
Name | N-[(4R)-4-(3H-imidazo[4,5-c]pyridin-2-yl)-4H-fluoren-9-yl]quinoline-5-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920693
|
PDB chain | 2yke Chain A Residue 1224
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|