Structure of PDB 2xx2 Chain A Binding Site BS01 |
|
|
Ligand ID | 13C |
InChI | InChI=1S/C17H20ClNO4/c18-16-12-9-11(20)7-5-3-1-2-4-6-8-19-17(23)15(12)13(21)10-14(16)22/h2,4,10,21-22H,1,3,5-9H2,(H,19,23)/b4-2+ |
InChIKey | VRMUAANRIKUQHN-DUXPYHPUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.6.1 | c1c(c2c(c(c1O)Cl)CC(=O)CCCCC=CCCNC2=O)O | CACTVS 3.352 | Oc1cc(O)c2C(=O)NCCC=CCCCCC(=O)Cc2c1Cl | CACTVS 3.352 | Oc1cc(O)c2C(=O)NCC/C=C/CCCCC(=O)Cc2c1Cl |
|
Formula | C17 H20 Cl N O4 |
Name | (5E)-13-CHLORO-14,16-DIHYDROXY-3,4,7,8,9,10-HEXAHYDRO-2-BENZAZACYCLOTETRADECINE-1,11(2H,12H)-DIONE |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920645
|
PDB chain | 2xx2 Chain A Residue 1215
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|