Structure of PDB 2xsb Chain A Binding Site BS01 |
|
|
Ligand ID | GDL |
InChI | InChI=1S/C8H13NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-7,10,12-13H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-/m1/s1 |
InChIKey | NELQYZRSPDCGRQ-DBRKOABJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC(=O)N[CH]1[CH](O)[CH](O)[CH](CO)OC1=O | OpenEye OEToolkits 1.5.0 | CC(=O)NC1C(C(C(OC1=O)CO)O)O | OpenEye OEToolkits 1.5.0 | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](OC1=O)CO)O)O | ACDLabs 10.04 | O=C1OC(CO)C(O)C(O)C1NC(=O)C | CACTVS 3.341 | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)OC1=O |
|
Formula | C8 H13 N O6 |
Name | 2-(acetylamido)-2-deoxy-D-glucono-1,5-lactone; 2-ACETAMIDO-2-DEOXY-D-GLUCONO-1,5-LACTONE |
ChEMBL | |
DrugBank | DB02813 |
ZINC | ZINC000005438581
|
PDB chain | 2xsb Chain A Residue 1436
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.1.169: protein O-GlcNAcase. |
|
|
|