Structure of PDB 2xk9 Chain A Binding Site BS01 |
|
|
Ligand ID | XK9 |
InChI | InChI=1S/C18H17N7O4/c1-10(22-23-18(19)24-27)11-5-7-13(8-6-11)20-17(26)14-9-12-3-2-4-15(25(28)29)16(12)21-14/h2-9,21,27H,1H3,(H,20,26)(H3,19,23,24)/b22-10+ |
InChIKey | CTGMEYONMRTKGL-LSHDLFTRSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CC(=NNC(=N)NO)c1ccc(NC(=O)c2[nH]c3c(cccc3[N+]([O-])=O)c2)cc1 | OpenEye OEToolkits 1.6.1 | CC(=NNC(=N)NO)c1ccc(cc1)NC(=O)c2cc3cccc(c3[nH]2)[N+](=O)[O-] | OpenEye OEToolkits 1.6.1 | C/C(=N\NC(=N)NO)/c1ccc(cc1)NC(=O)c2cc3cccc(c3[nH]2)[N+](=O)[O-] | CACTVS 3.352 | CC(=N\NC(=N)NO)/c1ccc(NC(=O)c2[nH]c3c(cccc3[N+]([O-])=O)c2)cc1 | ACDLabs 10.04 | [O-][N+](=O)c1cccc2c1nc(c2)C(=O)Nc3ccc(\C(=N\NC(=[N@H])NO)C)cc3 |
|
Formula | C18 H17 N7 O4 |
Name | N-{4-[(1E)-N-(N-hydroxycarbamimidoyl)ethanehydrazonoyl]phenyl}-7-nitro-1H-indole-2-carboxamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000043201721
|
PDB chain | 2xk9 Chain A Residue 1511
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|