Structure of PDB 2x5w Chain A Binding Site BS01 |
|
|
Ligand ID | K2B |
InChI | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h17-19,22-25H,6-16H2,1-5H3/t19-,22+,23-,24+,25+,26+,27-/m1/s1 |
InChIKey | NYOXRYYXRWJDKP-GYKMGIIDSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CC(C)CCC[CH](C)[CH]1CC[CH]2[CH]3CCC4=CC(=O)CC[C]4(C)[CH]3CC[C]12C | OpenEye OEToolkits 1.6.1 | CC(C)CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=CC(=O)CC[C@]34C)C | OpenEye OEToolkits 1.6.1 | CC(C)CCCC(C)C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C | CACTVS 3.352 | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C | ACDLabs 10.04 | O=C4C=C2C(C1CCC3(C(C1CC2)CCC3C(C)CCCC(C)C)C)(C)CC4 |
|
Formula | C27 H44 O |
Name | (8ALPHA,9BETA)-CHOLEST-4-EN-3-ONE |
ChEMBL | CHEMBL63243 |
DrugBank | |
ZINC | ZINC000100060554
|
PDB chain | 2x5w Chain A Residue 1429
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|