Structure of PDB 2wmx Chain A Binding Site BS01 |
|
|
Ligand ID | ZY6 |
InChI | InChI=1S/C17H19N5O/c18-8-13-11-22(6-7-23-13)16-14(12-4-2-1-3-5-12)9-19-17-15(16)10-20-21-17/h1-5,9-10,13H,6-8,11,18H2,(H,19,20,21)/t13-/m0/s1 |
InChIKey | YBRZCAKSBYWZTC-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | n2cc1c(c(cnc1n2)c3ccccc3)N4CC(OCC4)CN | OpenEye OEToolkits 1.6.1 | c1ccc(cc1)c2cnc3c(c2N4CCO[C@H](C4)CN)cn[nH]3 | CACTVS 3.352 | NC[C@H]1CN(CCO1)c2c3cn[nH]c3ncc2c4ccccc4 | CACTVS 3.352 | NC[CH]1CN(CCO1)c2c3cn[nH]c3ncc2c4ccccc4 | OpenEye OEToolkits 1.6.1 | c1ccc(cc1)c2cnc3c(c2N4CCOC(C4)CN)cn[nH]3 |
|
Formula | C17 H19 N5 O |
Name | 1-[(2S)-4-(5-phenyl-1H-pyrazolo[3,4-b]pyridin-4-yl)morpholin-2-yl]methanamine |
ChEMBL | CHEMBL562314 |
DrugBank | DB08774 |
ZINC | ZINC000039001862
|
PDB chain | 2wmx Chain A Residue 1270
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|