Structure of PDB 2wka Chain A Binding Site BS01 |
|
|
Ligand ID | P89 |
InChI | InChI=1S/C19H31N2O6P/c1-3-4-5-6-7-8-9-10-17(22)12-20-13-18-16(14-27-28(24,25)26)11-21-15(2)19(18)23/h11,13,23H,3-10,12,14H2,1-2H3,(H2,24,25,26)/b20-13+ |
InChIKey | NFGPSQDCIMWBHR-DEDYPNTBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 2.0.6 | CCCCCCCCCC(=O)CN=Cc1c(cnc(c1O)C)COP(=O)(O)O | OpenEye OEToolkits 2.0.6 | CCCCCCCCCC(=O)C/N=C/c1c(cnc(c1O)C)COP(=O)(O)O | CACTVS 3.385 | CCCCCCCCCC(=O)CN=Cc1c(O)c(C)ncc1CO[P](O)(O)=O |
|
Formula | C19 H31 N2 O6 P |
Name | [6-methyl-5-oxidanyl-4-[(~{E})-2-oxidanylideneundecyliminomethyl]pyridin-3-yl]methyl dihydrogen phosphate |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 2wka Chain A Residue 605
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|