Structure of PDB 2wi7 Chain A Binding Site BS01 |
|
|
Ligand ID | 2KL |
InChI | InChI=1S/C21H23Cl2N5O2S/c1-2-25-19(29)17-10-13-18(26-21(24)27-20(13)31-17)12-9-16(15(23)11-14(12)22)30-8-7-28-5-3-4-6-28/h9-11H,2-8H2,1H3,(H,25,29)(H2,24,26,27) |
InChIKey | WJUNQSYQHHIVFX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 11.02 | Clc4c(OCCN1CCCC1)cc(c2nc(nc3sc(cc23)C(=O)NCC)N)c(Cl)c4 | CACTVS 3.352 | CCNC(=O)c1sc2nc(N)nc(c3cc(OCCN4CCCC4)c(Cl)cc3Cl)c2c1 | OpenEye OEToolkits 1.7.0 | CCNC(=O)c1cc2c(nc(nc2s1)N)c3cc(c(cc3Cl)Cl)OCCN4CCCC4 |
|
Formula | C21 H23 Cl2 N5 O2 S |
Name | 2-amino-4-[2,4-dichloro-5-(2-pyrrolidin-1-ylethoxy)phenyl]-N-ethylthieno[2,3-d]pyrimidine-6-carboxamide |
ChEMBL | CHEMBL563327 |
DrugBank | DB06969 |
ZINC | ZINC000036966109
|
PDB chain | 2wi7 Chain A Residue 1224
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|