Structure of PDB 2w8f Chain A Binding Site BS01 |
|
|
Ligand ID | BS1 |
InChI | InChI=1S/C24H30NO/c1-25(2)19-13-14-20(25)16-21(15-19)26-24-22-9-5-3-7-17(22)11-12-18-8-4-6-10-23(18)24/h3-10,19-21,24H,11-16H2,1-2H3/q+1/t19-,20+,21- |
InChIKey | BADPXOSJBUEVTR-WKCHPHFGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.6.1 | C[N+]1(C2CCC1CC(C2)OC3c4ccccc4CCc5c3cccc5)C | CACTVS 3.352 | C[N+]1(C)[CH]2CC[CH]1CC(C2)O[CH]3c4ccccc4CCc5ccccc35 | CACTVS 3.352 | C[N+]1(C)[C@H]2CC[C@@H]1CC(C2)O[C@@H]3c4ccccc4CCc5ccccc35 | OpenEye OEToolkits 1.6.1 | C[N+]1([C@H]2CC[C@@H]1CC(C2)OC3c4ccccc4CCc5c3cccc5)C | ACDLabs 10.04 | O(C3c1ccccc1CCc2ccccc23)C5CC4[N+](C)(C(CC4)C5)C |
|
Formula | C24 H30 N O |
Name | (3-EXO)-3-(10,11-DIHYDRO-5H-DIBENZO[A,D][7]ANNULEN-5-YLOXY)-8,8-DIMETHYL-8-AZONIABICYCLO[3.2.1]OCTANE |
ChEMBL | |
DrugBank | DB07494 |
ZINC | ZINC000100035570
|
PDB chain | 2w8f Chain A Residue 1206
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|