Structure of PDB 2vwy Chain A Binding Site BS01 |
|
|
Ligand ID | 7X5 |
InChI | InChI=1S/C18H15ClN4O4S/c1-28(24,25)12-4-2-3-11(9-12)21-18-20-8-7-15(23-18)22-16-13(19)5-6-14-17(16)27-10-26-14/h2-9H,10H2,1H3,(H2,20,21,22,23) |
InChIKey | QTFCKBFCXDAZIU-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=S(=O)(c1cccc(c1)Nc2nccc(n2)Nc3c(Cl)ccc4OCOc34)C | OpenEye OEToolkits 1.5.0 | CS(=O)(=O)c1cccc(c1)Nc2nccc(n2)Nc3c(ccc4c3OCO4)Cl | CACTVS 3.341 | C[S](=O)(=O)c1cccc(Nc2nccc(Nc3c(Cl)ccc4OCOc34)n2)c1 |
|
Formula | C18 H15 Cl N4 O4 S |
Name | N'-(5-chloro-1,3-benzodioxol-4-yl)-N-(3-methylsulfonylphenyl)pyrimidine-2,4-diamine |
ChEMBL | CHEMBL445162 |
DrugBank | DB07253 |
ZINC | ZINC000029043084
|
PDB chain | 2vwy Chain A Residue 1889
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|