Structure of PDB 2vwx Chain A Binding Site BS01 |
|
|
Ligand ID | 7X4 |
InChI | InChI=1S/C17H14ClN5O4S/c18-12-4-5-13-16(27-9-26-13)15(12)22-14-6-7-20-17(23-14)21-10-2-1-3-11(8-10)28(19,24)25/h1-8H,9H2,(H2,19,24,25)(H2,20,21,22,23) |
InChIKey | TZHCXOMEOHEZDX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=S(=O)(N)c1cccc(c1)Nc2nccc(n2)Nc3c(Cl)ccc4OCOc34 | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)S(=O)(=O)N)Nc2nccc(n2)Nc3c(ccc4c3OCO4)Cl | CACTVS 3.341 | N[S](=O)(=O)c1cccc(Nc2nccc(Nc3c(Cl)ccc4OCOc34)n2)c1 |
|
Formula | C17 H14 Cl N5 O4 S |
Name | 3-({4-[(5-chloro-1,3-benzodioxol-4-yl)amino]pyrimidin-2-yl}amino)benzenesulfonamide |
ChEMBL | CHEMBL257553 |
DrugBank | DB07252 |
ZINC | ZINC000029043180
|
PDB chain | 2vwx Chain A Residue 1889
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|