Structure of PDB 2vwu Chain A Binding Site BS01 |
|
|
Ligand ID | 7X1 |
InChI | InChI=1S/C24H27ClN4O4/c1-30-20-12-16-18(13-21(20)31-11-5-10-29-8-3-2-4-9-29)26-14-27-24(16)28-22-17(25)6-7-19-23(22)33-15-32-19/h6-7,12-14H,2-5,8-11,15H2,1H3,(H,26,27,28) |
InChIKey | QHIMVPIOWKYPSO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | COc1cc2c(cc1OCCCN3CCCCC3)ncnc2Nc4c(ccc5c4OCO5)Cl | ACDLabs 10.04 | Clc1ccc5OCOc5c1Nc4ncnc3c4cc(OC)c(OCCCN2CCCCC2)c3 | CACTVS 3.341 | COc1cc2c(Nc3c(Cl)ccc4OCOc34)ncnc2cc1OCCCN5CCCCC5 |
|
Formula | C24 H27 Cl N4 O4 |
Name | N-(5-chloro-1,3-benzodioxol-4-yl)-6-methoxy-7-(3-piperidin-1-ylpropoxy)quinazolin-4-amine |
ChEMBL | CHEMBL169186 |
DrugBank | DB07249 |
ZINC | ZINC000003938356
|
PDB chain | 2vwu Chain A Residue 1888
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|