Structure of PDB 2vgo Chain A Binding Site BS01 |
|
|
Ligand ID | AD5 |
InChI | InChI=1S/C21H27N7O/c1-2-4-15(5-3-1)24-20-18-19(23-14-22-18)26-21(27-20)25-16-6-8-17(9-7-16)28-10-12-29-13-11-28/h6-9,14-15H,1-5,10-13H2,(H3,22,23,24,25,26,27) |
InChIKey | ZFLJHSQHILSNCM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | C1CCC(CC1)Nc2nc(Nc3ccc(cc3)N4CCOCC4)nc5[nH]cnc25 | OpenEye OEToolkits 1.5.0 | c1cc(ccc1Nc2nc3c(c(n2)NC4CCCCC4)nc[nH]3)N5CCOCC5 | ACDLabs 10.04 | n2c1ncnc1c(nc2Nc4ccc(N3CCOCC3)cc4)NC5CCCCC5 |
|
Formula | C21 H27 N7 O |
Name | N~6~-cyclohexyl-N~2~-(4-morpholin-4-ylphenyl)-9H-purine-2,6-diamine; Reversine |
ChEMBL | CHEMBL188343 |
DrugBank | DB07340 |
ZINC | ZINC000003620786
|
PDB chain | 2vgo Chain A Residue 1357
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|