Structure of PDB 2vf3 Chain A Binding Site BS01 |
|
|
Ligand ID | GVS |
InChI | InChI=1S/C17H22N4O6S/c1-2-27-14(22)8-17(10-26-11-17)21-9-12(15(18)20-16(21)23)4-3-7-19-28(24,25)13-5-6-13/h9,13,19H,2,5-8,10-11H2,1H3,(H2,18,20,23) |
InChIKey | MIAWQMZUJQYSPX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CCOC(=O)CC1(COC1)N2C=C(C(=NC2=O)N)C#CCNS(=O)(=O)C3CC3 | ACDLabs 10.04 | O=S(=O)(NCC#CC=1C(=NC(=O)N(C=1)C2(COC2)CC(=O)OCC)N)C3CC3 | CACTVS 3.341 | CCOC(=O)CC1(COC1)N2C=C(C#CCN[S](=O)(=O)C3CC3)C(=NC2=O)N |
|
Formula | C17 H22 N4 O6 S |
Name | ethyl {3-[4-amino-5-{3-[(cyclopropylsulfonyl)amino]prop-1-yn-1-yl}-2-oxopyrimidin-1(2H)-yl]oxetan-3-yl}acetate |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058650720
|
PDB chain | 2vf3 Chain A Residue 1269
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K9 D130 |
Catalytic site (residue number reindexed from 1) |
K10 D131 |
Enzyme Commision number |
2.7.1.148: 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol kinase. |
|
|
|