Structure of PDB 2vcj Chain A Binding Site BS01 |
|
|
Ligand ID | 2EQ |
InChI | InChI=1S/C23H24ClN3O5/c1-2-25-23(30)21-20(22(32-26-21)16-11-17(24)19(29)12-18(16)28)15-5-3-14(4-6-15)13-27-7-9-31-10-8-27/h3-6,11-12,28-29H,2,7-10,13H2,1H3,(H,25,30) |
InChIKey | APGOABVITLQCKW-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CCNC(=O)c1noc(c2cc(Cl)c(O)cc2O)c1c3ccc(CN4CCOCC4)cc3 | OpenEye OEToolkits 1.5.0 | CCNC(=O)c1c(c(on1)c2cc(c(cc2O)O)Cl)c3ccc(cc3)CN4CCOCC4 | ACDLabs 10.04 | Clc1cc(c(O)cc1O)c2onc(C(=O)NCC)c2c3ccc(cc3)CN4CCOCC4 |
|
Formula | C23 H24 Cl N3 O5 |
Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-4-[4-(morpholin-4-ylmethyl)phenyl]isoxazole-3-carboxamide |
ChEMBL | CHEMBL398346 |
DrugBank | DB06961 |
ZINC | ZINC000014974863
|
PDB chain | 2vcj Chain A Residue 1224
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.6.4.10: non-chaperonin molecular chaperone ATPase. |
|
|
|