Structure of PDB 2rah Chain A Binding Site BS01 |
|
|
Ligand ID | 11P |
InChI | InChI=1S/C9H13NO7P2/c11-9(18(12,13)14,19(15,16)17)8-2-1-6-3-4-10-5-7(6)8/h3-5,8,11H,1-2H2,(H2,12,13,14)(H2,15,16,17)/t8-/m1/s1 |
InChIKey | WBALRBOBYFLYPZ-MRVPVSSYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC([CH]1CCc2ccncc12)([P](O)(O)=O)[P](O)(O)=O | CACTVS 3.341 | OC([C@@H]1CCc2ccncc12)([P](O)(O)=O)[P](O)(O)=O | OpenEye OEToolkits 1.5.0 | c1cncc2c1CCC2C(O)(P(=O)(O)O)P(=O)(O)O | OpenEye OEToolkits 1.5.0 | c1cncc2c1CC[C@H]2C(O)(P(=O)(O)O)P(=O)(O)O | ACDLabs 10.04 | O=P(O)(O)C(O)(C2c1c(ccnc1)CC2)P(=O)(O)O |
|
Formula | C9 H13 N O7 P2 |
Name | [(7R)-6,7-dihydro-5H-cyclopenta[c]pyridin-7-yl(hydroxy)methylene]bis(phosphonic acid) |
ChEMBL | |
DrugBank | |
ZINC | ZINC000016052517
|
PDB chain | 2rah Chain A Residue 356
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|