Structure of PDB 2r0u Chain A Binding Site BS01 |
|
|
Ligand ID | M54 |
InChI | InChI=1S/C25H22N4O2/c26-8-2-4-17-11-22-23(16-3-1-5-19(30)9-16)14-27-25(31)24(22)21-10-15(6-7-20(17)21)18-12-28-29-13-18/h1,3,5-7,9-14,30H,2,4,8,26H2,(H,27,31)(H,28,29) |
InChIKey | BUSJQQYKXHYDNN-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C5c3c2c(ccc(c1cnnc1)c2)c(cc3C(c4cccc(O)c4)=CN5)CCCN | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)O)C2=CNC(=O)c3c2cc(c4c3cc(cc4)c5c[nH]nc5)CCCN | CACTVS 3.341 | NCCCc1cc2C(=CNC(=O)c2c3cc(ccc13)c4c[nH]nc4)c5cccc(O)c5 |
|
Formula | C25 H22 N4 O2 |
Name | 6-(3-aminopropyl)-4-(3-hydroxyphenyl)-9-(1H-pyrazol-4-yl)benzo[h]isoquinolin-1(2H)-one |
ChEMBL | CHEMBL249441 |
DrugBank | |
ZINC | ZINC000016052489
|
PDB chain | 2r0u Chain A Residue 324
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|