Structure of PDB 2qvr Chain A Binding Site BS01 |
|
|
Ligand ID | FDP |
InChI | InChI=1S/C6H14O12P2/c7-2-6(18-20(13,14)15)5(9)4(8)3(17-6)1-16-19(10,11)12/h3-5,7-9H,1-2H2,(H2,10,11,12)(H2,13,14,15)/t3-,4-,5+,6+/m1/s1 |
InChIKey | YXWOAJXNVLXPMU-ZXXMMSQZSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=P(OC1(OC(C(O)C1O)COP(=O)(O)O)CO)(O)O | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@H]([C@@H]([C@](O1)(CO)OP(=O)(O)O)O)O)OP(=O)(O)O | CACTVS 3.341 | OC[C]1(O[CH](CO[P](O)(O)=O)[CH](O)[CH]1O)O[P](O)(O)=O | CACTVS 3.341 | OC[C@]1(O[C@H](CO[P](O)(O)=O)[C@@H](O)[C@@H]1O)O[P](O)(O)=O | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(O1)(CO)OP(=O)(O)O)O)O)OP(=O)(O)O |
|
Formula | C6 H14 O12 P2 |
Name | 2,6-di-O-phosphono-beta-D-fructofuranose; FRUCTOSE-2,6-DIPHOSPHATE; 2,6-di-O-phosphono-beta-D-fructose; 2,6-di-O-phosphono-D-fructose; 2,6-di-O-phosphono-fructose |
ChEMBL | |
DrugBank | |
ZINC | ZINC000004228295
|
PDB chain | 2qvr Chain A Residue 333
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|