Structure of PDB 2o2u Chain A Binding Site BS01 |
|
|
Ligand ID | 738 |
InChI | InChI=1S/C16H13FN2OS/c17-13-7-3-1-6-11(13)15(20)19-16-12(9-18)10-5-2-4-8-14(10)21-16/h1,3,6-7H,2,4-5,8H2,(H,19,20) |
InChIKey | YVYPYORTKAIUGJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1ccc(c(c1)C(=O)Nc2c(c3c(s2)CCCC3)C#N)F | ACDLabs 10.04 | Fc1ccccc1C(=O)Nc2sc3c(c2C#N)CCCC3 | CACTVS 3.341 | Fc1ccccc1C(=O)Nc2sc3CCCCc3c2C#N |
|
Formula | C16 H13 F N2 O S |
Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothien-2-yl)-2-fluorobenzamide |
ChEMBL | CHEMBL234838 |
DrugBank | DB07217 |
ZINC | ZINC000000244028
|
PDB chain | 2o2u Chain A Residue 403
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|