Structure of PDB 2mvv Chain A Binding Site BS01 |
|
|
Ligand ID | SXR |
InChI | InChI=1S/C22H35N2O7PS/c1-22(2,16-31-32(29)30)20(27)21(28)24-12-10-19(26)23-13-15-33-14-11-18(25)9-8-17-6-4-3-5-7-17/h3-7,20,27,29-30H,8-16H2,1-2H3,(H,23,26)(H,24,28)/t20-/m1/s1 |
InChIKey | FUUCQARVEOTYOO-HXUWFJFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.385 | CC(C)(COP(O)O)[CH](O)C(=O)NCCC(=O)NCCSCCC(=O)CCc1ccccc1 | OpenEye OEToolkits 1.7.6 | CC(C)(COP(O)O)C(C(=O)NCCC(=O)NCCSCCC(=O)CCc1ccccc1)O | OpenEye OEToolkits 1.7.6 | CC(C)(COP(O)O)[C@@H](C(=O)NCCC(=O)NCCSCCC(=O)CCc1ccccc1)O | CACTVS 3.385 | CC(C)(COP(O)O)[C@H](O)C(=O)NCCC(=O)NCCSCCC(=O)CCc1ccccc1 | ACDLabs 12.01 | O=C(NCCC(=O)NCCSCCC(=O)CCc1ccccc1)C(O)C(C)(C)COP(O)O |
|
Formula | C22 H35 N2 O7 P S |
Name | N~3~-{(2S)-4-[(dihydroxyphosphanyl)oxy]-2-hydroxy-3,3-dimethylbutanoyl}-N-{2-[(3-oxo-5-phenylpentyl)sulfanyl]ethyl}-beta-alaninamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263620442
|
PDB chain | 2mvv Chain A Residue 101
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|