Structure of PDB 2lzg Chain A Binding Site BS01 |
|
|
Ligand ID | 13Q |
InChI | InChI=1S/C23H23Cl2NO3/c24-18-8-6-15(7-9-18)22-20(16-2-1-3-19(25)10-16)11-17(12-21(27)28)23(29)26(22)13-14-4-5-14/h1-3,6-10,14,17,20,22H,4-5,11-13H2,(H,27,28)/t17-,20-,22-/m1/s1 |
InChIKey | OMAPWASVHLHIRY-NQSCKRDGSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)C[CH]1C[CH]([CH](N(CC2CC2)C1=O)c3ccc(Cl)cc3)c4cccc(Cl)c4 | CACTVS 3.370 | OC(=O)C[C@H]1C[C@@H]([C@H](N(CC2CC2)C1=O)c3ccc(Cl)cc3)c4cccc(Cl)c4 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)Cl)C2CC(C(=O)N(C2c3ccc(cc3)Cl)CC4CC4)CC(=O)O | ACDLabs 12.01 | O=C(O)CC4C(=O)N(CC1CC1)C(c2ccc(Cl)cc2)C(c3cccc(Cl)c3)C4 | OpenEye OEToolkits 1.7.6 | c1cc(cc(c1)Cl)[C@H]2C[C@@H](C(=O)N([C@@H]2c3ccc(cc3)Cl)CC4CC4)CC(=O)O |
|
Formula | C23 H23 Cl2 N O3 |
Name | [(3R,5R,6S)-5-(3-chlorophenyl)-6-(4-chlorophenyl)-1-(cyclopropylmethyl)-2-oxopiperidin-3-yl]acetic acid |
ChEMBL | CHEMBL2177813 |
DrugBank | |
ZINC | ZINC000095576270
|
PDB chain | 2lzg Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.3.2.27: RING-type E3 ubiquitin transferase. |
|
|
|