Structure of PDB 2ly0 Chain A Binding Site BS01 |
|
|
Ligand ID | A2Y |
InChI | InChI=1S/C18H22N2OS/c1-2-17(22-3-1)16-7-15(20-21-16)11-19-18-8-12-4-13(9-18)6-14(5-12)10-18/h1-3,7,12-14,19H,4-6,8-11H2/p+1/t12-,13+,14-,18- |
InChIKey | PBZWFIHUWUZQDJ-WXZYKRPKSA-O |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1cc(sc1)c2cc(no2)C[NH2+]C34CC5CC(C3)CC(C5)C4 | ACDLabs 12.01 | n2oc(c1sccc1)cc2C[NH2+]C45CC3CC(CC(C3)C4)C5 | CACTVS 3.370 | C([NH2+]C12CC3CC(CC(C3)C1)C2)c4cc(on4)c5sccc5 |
|
Formula | C18 H23 N2 O S |
Name | (3S,5S,7S)-N-{[5-(thiophen-2-yl)-1,2-oxazol-3-yl]methyl}tricyclo[3.3.1.1~3,7~]decan-1-aminium |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 2ly0 Chain A Residue 100
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|