Structure of PDB 2jal Chain A Binding Site BS01 |
|
|
Ligand ID | YLL |
InChI | InChI=1S/C7H14O6/c8-1-2-3(9)5(11)7(13)6(12)4(2)10/h2-13H,1H2/t2-,3-,4-,5+,6+,7-/m1/s1 |
InChIKey | QFYQIWDMMSKNFF-NYLBLOMBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C(C1C(C(C(C(C1O)O)O)O)O)O | OpenEye OEToolkits 1.5.0 | C(C1[C@H]([C@@H](C([C@H]([C@@H]1O)O)O)O)O)O | CACTVS 3.341 | OC[CH]1[CH](O)[CH](O)[CH](O)[CH](O)[CH]1O | CACTVS 3.341 | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O | ACDLabs 10.04 | OC1C(C(O)C(O)C(O)C1O)CO |
|
Formula | C7 H14 O6 |
Name | (1R,2S,3S,4S,5R,6R)-6-(HYDROXYMETHYL)CYCLOHEXANE-1,2,3,4,5-PENTOL |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 2jal Chain A Residue 1446
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|