Structure of PDB 2iwu Chain A Binding Site BS01 |
|
|
Ligand ID | NP5 |
InChI | InChI=1S/C16H17ClO5/c17-15-11-8-10(18)6-4-2-1-3-5-7-22-16(21)14(11)12(19)9-13(15)20/h1,3,9,19-20H,2,4-8H2/b3-1+ |
InChIKey | AQKZYZQONWDDLS-HNQUOIGGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1c(c2c(c(c1O)Cl)CC(=O)CCC\C=C\CCOC2=O)O | ACDLabs 10.04 | O=C1OCCC=CCCCC(=O)Cc2c1c(O)cc(O)c2Cl | CACTVS 3.341 | Oc1cc(O)c2C(=O)OCCC=CCCCC(=O)Cc2c1Cl | CACTVS 3.341 | Oc1cc(O)c2C(=O)OCC/C=C/CCCC(=O)Cc2c1Cl | OpenEye OEToolkits 1.5.0 | c1c(c2c(c(c1O)Cl)CC(=O)CCCC=CCCOC2=O)O |
|
Formula | C16 H17 Cl O5 |
Name | (5E)-12-CHLORO-13,15-DIHYDROXY-4,7,8,9-TETRAHYDRO-2-BENZOXACYCLOTRIDECINE-1,10(3H,11H)-DIONE |
ChEMBL | |
DrugBank | DB08293 |
ZINC | ZINC000036966121
|
PDB chain | 2iwu Chain A Residue 1215
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|