Structure of PDB 2fue Chain A Binding Site BS01 |
|
|
Ligand ID | M1P |
InChI | InChI=1S/C6H13O9P/c7-1-2-3(8)4(9)5(10)6(14-2)15-16(11,12)13/h2-10H,1H2,(H2,11,12,13)/t2-,3-,4+,5+,6-/m1/s1 |
InChIKey | HXXFSFRBOHSIMQ-RWOPYEJCSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[CH]1O[CH](O[P](O)(O)=O)[CH](O)[CH](O)[CH]1O | CACTVS 3.341 | OC[C@H]1O[C@H](O[P](O)(O)=O)[C@@H](O)[C@@H](O)[C@@H]1O | ACDLabs 10.04 | O=P(OC1OC(C(O)C(O)C1O)CO)(O)O | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OP(=O)(O)O)O)O)O)O | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(C(O1)OP(=O)(O)O)O)O)O)O |
|
Formula | C6 H13 O9 P |
Name | 1-O-phosphono-alpha-D-mannopyranose; ALPHA-D-MANNOSE 1-PHOSPHATE; 1-O-phosphono-alpha-D-mannose; 1-O-phosphono-D-mannose; 1-O-phosphono-mannose |
ChEMBL | CHEMBL291890 |
DrugBank | DB17678 |
ZINC | ZINC000004095569
|
PDB chain | 2fue Chain A Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
5.4.2.8: phosphomannomutase. |
|
|
|