Structure of PDB 2cet Chain A Binding Site BS01 |
|
|
Ligand ID | PGI |
InChI | InChI=1S/C16H20N2O4/c19-9-12-13(20)14(21)15(22)16-17-11(8-18(12)16)7-6-10-4-2-1-3-5-10/h1-5,8,12-15,19-22H,6-7,9H2/p+1/t12-,13-,14+,15-/m1/s1 |
InChIKey | MLRMIFDEZCZOAE-APIJFGDWSA-O |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1ccc(cc1)CCc2c[n+]3c([nH]2)C(C(C(C3CO)O)O)O | CACTVS 3.341 | OC[CH]1[CH](O)[CH](O)[CH](O)c2[nH]c(CCc3ccccc3)c[n+]12 | OpenEye OEToolkits 1.5.0 | c1ccc(cc1)CCc2c[n+]3c([nH]2)[C@@H]([C@H]([C@@H]([C@H]3CO)O)O)O | CACTVS 3.341 | OC[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)c2[nH]c(CCc3ccccc3)c[n+]12 | ACDLabs 10.04 | OCC2[n+]1cc(nc1C(O)C(O)C2O)CCc3ccccc3 |
|
Formula | C16 H21 N2 O4 |
Name | (5R,6R,7S,8S)-5-(HYDROXYMETHYL)-2-(2-PHENYLETHYL)-1,5,6,7,8,8A-HEXAHYDROIMIDAZO[1,2-A]PYRIDINE-6,7,8-TRIOL |
ChEMBL | |
DrugBank | |
ZINC | ZINC000103553232
|
PDB chain | 2cet Chain A Residue 1447
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|