Structure of PDB 2cbr Chain A Binding Site BS01 |
|
|
Ligand ID | A80 |
InChI | InChI=1S/C22H25NO3/c1-21(2)11-12-22(3,4)18-13-16(9-10-17(18)21)23-19(24)14-5-7-15(8-6-14)20(25)26/h5-10,13H,11-12H2,1-4H3,(H,23,24)(H,25,26) |
InChIKey | MUTNCGKQJGXKEM-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CC1(C)CCC(C)(C)c2cc(NC(=O)c3ccc(cc3)C(O)=O)ccc12 | OpenEye OEToolkits 1.7.2 | CC1(CCC(c2c1ccc(c2)NC(=O)c3ccc(cc3)C(=O)O)(C)C)C | ACDLabs 12.01 | O=C(O)c1ccc(cc1)C(=O)Nc2ccc3c(c2)C(CCC3(C)C)(C)C |
|
Formula | C22 H25 N O3 |
Name | 4-[(5,5,8,8-tetramethyl-5,6,7,8-tetrahydronaphthalen-2-yl)carbamoyl]benzoic acid |
ChEMBL | CHEMBL25202 |
DrugBank | DB04942 |
ZINC | ZINC000000538415
|
PDB chain | 2cbr Chain A Residue 201
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|