Structure of PDB 1yim Chain A Binding Site BS01 |
|
|
Ligand ID | CM4 |
InChI | InChI=1S/C28H31NO4/c1-19-25-18-23(31)10-13-26(25)33-28(27(19)20-4-8-22(30)9-5-20)21-6-11-24(12-7-21)32-17-16-29-14-2-3-15-29/h4-13,18-19,27-28,30-31H,2-3,14-17H2,1H3/t19-,27-,28+/m1/s1 |
InChIKey | XPVKGTWRXBSJKO-LHXLBICKSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C[C@@H]1c2cc(ccc2O[C@H]([C@H]1c3ccc(cc3)O)c4ccc(cc4)OCCN5CCCC5)O | OpenEye OEToolkits 1.5.0 | CC1c2cc(ccc2OC(C1c3ccc(cc3)O)c4ccc(cc4)OCCN5CCCC5)O | CACTVS 3.341 | C[C@H]1[C@@H]([C@@H](Oc2ccc(O)cc12)c3ccc(OCCN4CCCC4)cc3)c5ccc(O)cc5 | CACTVS 3.341 | C[CH]1[CH]([CH](Oc2ccc(O)cc12)c3ccc(OCCN4CCCC4)cc3)c5ccc(O)cc5 | ACDLabs 10.04 | Oc1ccc(cc1)C4C(c5c(OC4c3ccc(OCCN2CCCC2)cc3)ccc(O)c5)C |
|
Formula | C28 H31 N O4 |
Name | (2R,3R,4S)-3-(4-HYDROXYPHENYL)-4-METHYL-2-[4-(2-PYRROLIDIN-1-YLETHOXY)PHENYL]CHROMAN-6-OL |
ChEMBL | CHEMBL181936 |
DrugBank | DB07567 |
ZINC | ZINC000016051697
|
PDB chain | 1yim Chain A Residue 600
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|