Structure of PDB 1s1j Chain A Binding Site BS01 |
|
|
Ligand ID | IQZ |
InChI | InChI=1S/C15H16N2O/c18-13-9-17-8-4-3-7-12(17)15-14(13)10-5-1-2-6-11(10)16-15/h1-2,5-6,12,16H,3-4,7-9H2/t12-/m0/s1 |
InChIKey | PGKUSHWBQJPFOP-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.6.1 | c1ccc2c(c1)c3c([nH]2)C4CCCCN4CC3=O | OpenEye OEToolkits 1.6.1 | c1ccc2c(c1)c3c([nH]2)[C@@H]4CCCC[N@]4CC3=O | CACTVS 3.352 | O=C1CN2CCCC[CH]2c3[nH]c4ccccc4c13 | CACTVS 3.352 | O=C1CN2CCCC[C@H]2c3[nH]c4ccccc4c13 |
|
Formula | C15 H16 N2 O |
Name | (12bS)-1,2,3,4,12,12b-hexahydroindolo[2,3-a]quinolizin-7(6H)-one |
ChEMBL | |
DrugBank | DB02191 |
ZINC |
|
PDB chain | 1s1j Chain A Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|