Structure of PDB 1o9w Chain A Binding Site BS01 |
|
|
Ligand ID | NAG |
InChI | InChI=1S/C8H15NO6/c1-3(11)9-5-7(13)6(12)4(2-10)15-8(5)14/h4-8,10,12-14H,2H2,1H3,(H,9,11)/t4-,5-,6-,7-,8-/m1/s1 |
InChIKey | OVRNDRQMDRJTHS-FMDGEEDCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1O)CO)O)O | CACTVS 3.370 | CC(=O)N[CH]1[CH](O)O[CH](CO)[CH](O)[CH]1O | CACTVS 3.370 | CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O)[C@@H]1O | ACDLabs 12.01 | O=C(NC1C(O)C(O)C(OC1O)CO)C | OpenEye OEToolkits 1.7.6 | CC(=O)NC1C(C(C(OC1O)CO)O)O |
|
Formula | C8 H15 N O6 |
Name | 2-acetamido-2-deoxy-beta-D-glucopyranose; N-acetyl-beta-D-glucosamine; 2-acetamido-2-deoxy-beta-D-glucose; 2-acetamido-2-deoxy-D-glucose; 2-acetamido-2-deoxy-glucose; N-ACETYL-D-GLUCOSAMINE |
ChEMBL | CHEMBL447878 |
DrugBank | |
ZINC | ZINC000003983907
|
PDB chain | 1o9w Chain A Residue 1177
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|